C16H26Cl2N4O3 — CID 119868290
N-[4-[3-(dimethylamino)propanoylamino]phenyl]morpholine-2-carboxamide;dihydrochloride (PubChem CID 119868290) has the molecular formula C16H26Cl2N4O3 and a molecular weight of 393.32 g/mol. Its IUPAC name is N-[4-[3-(dimethylamino)propanoylamino]phenyl]morpholine-2-carboxamide;dihydrochloride.
| Compound Name | N-[4-[3-(dimethylamino)propanoylamino]phenyl]morpholine-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119868290 |
| Molecular Formula | C16H26Cl2N4O3 |
| Molecular Weight | 393.32 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | N-[4-[3-(dimethylamino)propanoylamino]phenyl]morpholine-2-carboxamide;dihydrochloride |
| SMILES | CN(C)CCC(=O)Nc1ccc(NC(=O)C2CNCCO2)cc1.Cl.Cl |
| InChI | InChI=1S/C16H24N4O3.2ClH/c1-20(2)9-7-15(21)18-12-3-5-13(6-4-12)19-16(22)14-11-17-8-10-23-14;;/h3-6,14,17H,7-11H2,1-2H3,(H,18,21)(H,19,22);2*1H |
| InChIKey | OIGAIMSHLONELJ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.32 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |