C14H27Cl2N3O — CID 119868312
1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl-[(2R)-piperidin-2-yl]methanone;dihydrochloride (PubChem CID 119868312) has the molecular formula C14H27Cl2N3O and a molecular weight of 324.30 g/mol. Its IUPAC name is 1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl-[(2R)-piperidin-2-yl]methanone;dihydrochloride.
| Compound Name | 1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl-[(2R)-piperidin-2-yl]methanone;dihydrochloride |
|---|---|
| PubChem CID | 119868312 |
| Molecular Formula | C14H27Cl2N3O |
| Molecular Weight | 324.30 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl-[(2R)-piperidin-2-yl]methanone;dihydrochloride |
| SMILES | Cl.Cl.O=C([C@H]1CCCCN1)N1CCN2CCCCC2C1 |
| InChI | InChI=1S/C14H25N3O.2ClH/c18-14(13-6-1-3-7-15-13)17-10-9-16-8-4-2-5-12(16)11-17;;/h12-13,15H,1-11H2;2*1H/t12?,13-;;/m1../s1 |
| InChIKey | DGUAPQHTCBPIFL-VCNBZBSISA-N |
| XLogP | 1.67 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.30 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |