About (NZ)-N-(1-cyclopenta-2,4-dien-1-ylethylidene)hydroxylamine;cyclopentane;iron
(NZ)-N-(1-cyclopenta-2,4-dien-1-ylethylidene)hydroxylamine;cyclopentane;iron (PubChem CID 11986865) has the molecular formula C12H13FeNO-6
and a molecular weight of 243.09 g/mol. Its IUPAC name is (NZ)-N-(1-cyclopenta-2,4-dien-1-ylethylidene)hydroxylamine;cyclopentane;iron.
Molecular Properties
| Compound Name | (NZ)-N-(1-cyclopenta-2,4-dien-1-ylethylidene)hydroxylamine;cyclopentane;iron |
| PubChem CID | 11986865 |
| Molecular Formula | C12H13FeNO-6 |
| Molecular Weight | 243.09 g/mol |
| Exact Mass | 243.04 |
| IUPAC Name | (NZ)-N-(1-cyclopenta-2,4-dien-1-ylethylidene)hydroxylamine;cyclopentane;iron |
| SMILES | C/C(=N/O)[c-]1cccc1.[Fe].[cH-]1[cH-][cH-][cH-][cH-]1 |
| InChI | InChI=1S/C7H8NO.C5H5.Fe/c1-6(8-9)7-4-2-3-5-7;1-2-4-5-3-1;/h2-5,9H,1H3;1-5H;/q-1;-5;/b8-6-;; |
| InChIKey | KSHIWMDULSISJU-OTDBEEGXSA-N |
| XLogP | 3.01 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.09 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (NZ)-N-(1-cyclopenta-2,4-dien-1-ylethylidene)hydroxylamine;cyclopentane;iron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NZ)-N-(1-cyclopenta-2,4-dien-1-ylethylidene)hydroxylamine;cyclopentane;iron?
The IUPAC name of (NZ)-N-(1-cyclopenta-2,4-dien-1-ylethylidene)hydroxylamine;cyclopentane;iron (CID 11986865) is (NZ)-N-(1-cyclopenta-2,4-dien-1-ylethylidene)hydroxylamine;cyclopentane;iron.
What is the SMILES notation for (NZ)-N-(1-cyclopenta-2,4-dien-1-ylethylidene)hydroxylamine;cyclopentane;iron?
The canonical SMILES for (NZ)-N-(1-cyclopenta-2,4-dien-1-ylethylidene)hydroxylamine;cyclopentane;iron is C/C(=N/O)[c-]1cccc1.[Fe].[cH-]1[cH-][cH-][cH-][cH-]1.
What is the InChIKey of (NZ)-N-(1-cyclopenta-2,4-dien-1-ylethylidene)hydroxylamine;cyclopentane;iron?
The InChIKey is KSHIWMDULSISJU-OTDBEEGXSA-N. The full InChI is InChI=1S/C7H8NO.C5H5.Fe/c1-6(8-9)7-4-2-3-5-7;1-2-4-5-3-1;/h2-5,9H,1H3;1-5H;/q-1;-5;/b8-6-;;.
What are the key properties of (NZ)-N-(1-cyclopenta-2,4-dien-1-ylethylidene)hydroxylamine;cyclopentane;iron?
(NZ)-N-(1-cyclopenta-2,4-dien-1-ylethylidene)hydroxylamine;cyclopentane;iron has a molecular weight of 243.09 g/mol, XLogP of 3.01, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (NZ)-N-(1-cyclopenta-2,4-dien-1-ylethylidene)hydroxylamine;cyclopentane;iron is sourced from PubChem (CID 11986865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).