C20H25Ti-7 — CID 11986884
cyclopenta-1,3-diene;cyclopentane;1,2,3,4,5-pentamethylcyclopenta-1,3-diene;titanium (PubChem CID 11986884) has the molecular formula C20H25Ti-7 and a molecular weight of 313.29 g/mol. Its IUPAC name is cyclopenta-1,3-diene;cyclopentane;1,2,3,4,5-pentamethylcyclopenta-1,3-diene;titanium.
| Compound Name | cyclopenta-1,3-diene;cyclopentane;1,2,3,4,5-pentamethylcyclopenta-1,3-diene;titanium |
|---|---|
| PubChem CID | 11986884 |
| Molecular Formula | C20H25Ti-7 |
| Molecular Weight | 313.29 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | cyclopenta-1,3-diene;cyclopentane;1,2,3,4,5-pentamethylcyclopenta-1,3-diene;titanium |
| SMILES | Cc1c(C)c(C)[c-](C)c1C.[Ti].[cH-]1[cH-][cH-][cH-][cH-]1.c1cc[cH-]c1 |
| InChI | InChI=1S/C10H15.2C5H5.Ti/c1-6-7(2)9(4)10(5)8(6)3;2*1-2-4-5-3-1;/h1-5H3;2*1-5H;/q-1;-5;-1; |
| InChIKey | BVFINNJOZGEGKD-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.29 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|