C16H26Cl2N4O3 — CID 119869141
N-[3-[2-(dimethylamino)ethyl]-2-oxo-1,3-benzoxazol-5-yl]-4-(methylamino)butanamide;dihydrochloride (PubChem CID 119869141) has the molecular formula C16H26Cl2N4O3 and a molecular weight of 393.32 g/mol. Its IUPAC name is N-[3-[2-(dimethylamino)ethyl]-2-oxo-1,3-benzoxazol-5-yl]-4-(methylamino)butanamide;dihydrochloride.
| Compound Name | N-[3-[2-(dimethylamino)ethyl]-2-oxo-1,3-benzoxazol-5-yl]-4-(methylamino)butanamide;dihydrochloride |
|---|---|
| PubChem CID | 119869141 |
| Molecular Formula | C16H26Cl2N4O3 |
| Molecular Weight | 393.32 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | N-[3-[2-(dimethylamino)ethyl]-2-oxo-1,3-benzoxazol-5-yl]-4-(methylamino)butanamide;dihydrochloride |
| SMILES | CNCCCC(=O)Nc1ccc2oc(=O)n(CCN(C)C)c2c1.Cl.Cl |
| InChI | InChI=1S/C16H24N4O3.2ClH/c1-17-8-4-5-15(21)18-12-6-7-14-13(11-12)20(16(22)23-14)10-9-19(2)3;;/h6-7,11,17H,4-5,8-10H2,1-3H3,(H,18,21);2*1H |
| InChIKey | CVCCLARJLLOVPN-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.32 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|