C17H25N3O — CID 119869983
N-(2-propyl-1,3-dihydroisoindol-4-yl)piperidine-3-carboxamide (PubChem CID 119869983) has the molecular formula C17H25N3O and a molecular weight of 287.41 g/mol. Its IUPAC name is N-(2-propyl-1,3-dihydroisoindol-4-yl)piperidine-3-carboxamide.
| Compound Name | N-(2-propyl-1,3-dihydroisoindol-4-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 119869983 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | N-(2-propyl-1,3-dihydroisoindol-4-yl)piperidine-3-carboxamide |
| SMILES | CCCN1Cc2cccc(NC(=O)C3CCCNC3)c2C1 |
| InChI | InChI=1S/C17H25N3O/c1-2-9-20-11-14-5-3-7-16(15(14)12-20)19-17(21)13-6-4-8-18-10-13/h3,5,7,13,18H,2,4,6,8-12H2,1H3,(H,19,21) |
| InChIKey | BEYMBDZHKCGVHJ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |