C19H32Cl2N4O2 — CID 119870392
N-[3-[[2-(azepan-1-yl)acetyl]amino]phenyl]-4-(methylamino)butanamide;dihydrochloride (PubChem CID 119870392) has the molecular formula C19H32Cl2N4O2 and a molecular weight of 419.40 g/mol. Its IUPAC name is N-[3-[[2-(azepan-1-yl)acetyl]amino]phenyl]-4-(methylamino)butanamide;dihydrochloride.
| Compound Name | N-[3-[[2-(azepan-1-yl)acetyl]amino]phenyl]-4-(methylamino)butanamide;dihydrochloride |
|---|---|
| PubChem CID | 119870392 |
| Molecular Formula | C19H32Cl2N4O2 |
| Molecular Weight | 419.40 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | N-[3-[[2-(azepan-1-yl)acetyl]amino]phenyl]-4-(methylamino)butanamide;dihydrochloride |
| SMILES | CNCCCC(=O)Nc1cccc(NC(=O)CN2CCCCCC2)c1.Cl.Cl |
| InChI | InChI=1S/C19H30N4O2.2ClH/c1-20-11-7-10-18(24)21-16-8-6-9-17(14-16)22-19(25)15-23-12-4-2-3-5-13-23;;/h6,8-9,14,20H,2-5,7,10-13,15H2,1H3,(H,21,24)(H,22,25);2*1H |
| InChIKey | LLVPIGUNBXEFNJ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.40 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|