C16H31CoI2P — CID 11987151
diiodocobalt;1,2,3,4,5-pentamethylcyclopenta-1,3-diene;triethylphosphanium (PubChem CID 11987151) has the molecular formula C16H31CoI2P and a molecular weight of 567.14 g/mol. Its IUPAC name is diiodocobalt;1,2,3,4,5-pentamethylcyclopenta-1,3-diene;triethylphosphanium.
| Compound Name | diiodocobalt;1,2,3,4,5-pentamethylcyclopenta-1,3-diene;triethylphosphanium |
|---|---|
| PubChem CID | 11987151 |
| Molecular Formula | C16H31CoI2P |
| Molecular Weight | 567.14 g/mol |
| Exact Mass | 566.96 |
| IUPAC Name | diiodocobalt;1,2,3,4,5-pentamethylcyclopenta-1,3-diene;triethylphosphanium |
| SMILES | CC[PH+](CC)CC.Cc1c(C)c(C)[c-](C)c1C.I[Co]I |
| InChI | InChI=1S/C10H15.C6H15P.Co.2HI/c1-6-7(2)9(4)10(5)8(6)3;1-4-7(5-2)6-3;;;/h1-5H3;4-6H2,1-3H3;;2*1H/q-1;;+2;;/p-1 |
| InChIKey | USLXJDSFZDFHJK-UHFFFAOYSA-M |
| XLogP | 6.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.14 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|