About 2-cyclopenta-2,4-dien-1-ylidenepyridin-1-ide
2-cyclopenta-2,4-dien-1-ylidenepyridin-1-ide (PubChem CID 11987190) has the molecular formula C10H8N-
and a molecular weight of 142.18 g/mol. Its IUPAC name is 2-cyclopenta-2,4-dien-1-ylidenepyridin-1-ide.
Molecular Properties
| Compound Name | 2-cyclopenta-2,4-dien-1-ylidenepyridin-1-ide |
| PubChem CID | 11987190 |
| Molecular Formula | C10H8N- |
| Molecular Weight | 142.18 g/mol |
| Exact Mass | 142.07 |
| IUPAC Name | 2-cyclopenta-2,4-dien-1-ylidenepyridin-1-ide |
| SMILES | C1=C[N-]C(=C2C=CC=C2)C=C1 |
| InChI | InChI=1S/C10H8N/c1-2-6-9(5-1)10-7-3-4-8-11-10/h1-8H/q-1 |
| InChIKey | RGPVHXYVAPUTPJ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.18 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-cyclopenta-2,4-dien-1-ylidenepyridin-1-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopenta-2,4-dien-1-ylidenepyridin-1-ide?
The IUPAC name of 2-cyclopenta-2,4-dien-1-ylidenepyridin-1-ide (CID 11987190) is 2-cyclopenta-2,4-dien-1-ylidenepyridin-1-ide.
What is the SMILES notation for 2-cyclopenta-2,4-dien-1-ylidenepyridin-1-ide?
The canonical SMILES for 2-cyclopenta-2,4-dien-1-ylidenepyridin-1-ide is C1=C[N-]C(=C2C=CC=C2)C=C1.
What is the InChIKey of 2-cyclopenta-2,4-dien-1-ylidenepyridin-1-ide?
The InChIKey is RGPVHXYVAPUTPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N/c1-2-6-9(5-1)10-7-3-4-8-11-10/h1-8H/q-1.
What are the key properties of 2-cyclopenta-2,4-dien-1-ylidenepyridin-1-ide?
2-cyclopenta-2,4-dien-1-ylidenepyridin-1-ide has a molecular weight of 142.18 g/mol, XLogP of 2.82, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopenta-2,4-dien-1-ylidenepyridin-1-ide is sourced from PubChem (CID 11987190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).