About carbon monoxide;cobalt;3-cyclopenta-2,4-dien-1-ylpropyl(diphenyl)phosphanium
carbon monoxide;cobalt;3-cyclopenta-2,4-dien-1-ylpropyl(diphenyl)phosphanium (PubChem CID 11987204) has the molecular formula C21H21CoOP
and a molecular weight of 379.31 g/mol. Its IUPAC name is carbon monoxide;cobalt;3-cyclopenta-2,4-dien-1-ylpropyl(diphenyl)phosphanium.
Molecular Properties
| Compound Name | carbon monoxide;cobalt;3-cyclopenta-2,4-dien-1-ylpropyl(diphenyl)phosphanium |
| PubChem CID | 11987204 |
| Molecular Formula | C21H21CoOP |
| Molecular Weight | 379.31 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | carbon monoxide;cobalt;3-cyclopenta-2,4-dien-1-ylpropyl(diphenyl)phosphanium |
| SMILES | [C-]#[O+].[Co].c1ccc([PH+](CCC[c-]2cccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H20P.CO.Co/c1-3-13-19(14-4-1)21(20-15-5-2-6-16-20)17-9-12-18-10-7-8-11-18;1-2;/h1-8,10-11,13-16H,9,12,17H2;;/q-1;;/p+1 |
| InChIKey | YUBPYUIHMWBWDT-UHFFFAOYSA-O |
| XLogP | 4.16 |
| TPSA | 19.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.31 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze carbon monoxide;cobalt;3-cyclopenta-2,4-dien-1-ylpropyl(diphenyl)phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon monoxide;cobalt;3-cyclopenta-2,4-dien-1-ylpropyl(diphenyl)phosphanium?
The IUPAC name of carbon monoxide;cobalt;3-cyclopenta-2,4-dien-1-ylpropyl(diphenyl)phosphanium (CID 11987204) is carbon monoxide;cobalt;3-cyclopenta-2,4-dien-1-ylpropyl(diphenyl)phosphanium.
What is the SMILES notation for carbon monoxide;cobalt;3-cyclopenta-2,4-dien-1-ylpropyl(diphenyl)phosphanium?
The canonical SMILES for carbon monoxide;cobalt;3-cyclopenta-2,4-dien-1-ylpropyl(diphenyl)phosphanium is [C-]#[O+].[Co].c1ccc([PH+](CCC[c-]2cccc2)c2ccccc2)cc1.
What is the InChIKey of carbon monoxide;cobalt;3-cyclopenta-2,4-dien-1-ylpropyl(diphenyl)phosphanium?
The InChIKey is YUBPYUIHMWBWDT-UHFFFAOYSA-O. The full InChI is InChI=1S/C20H20P.CO.Co/c1-3-13-19(14-4-1)21(20-15-5-2-6-16-20)17-9-12-18-10-7-8-11-18;1-2;/h1-8,10-11,13-16H,9,12,17H2;;/q-1;;/p+1.
What are the key properties of carbon monoxide;cobalt;3-cyclopenta-2,4-dien-1-ylpropyl(diphenyl)phosphanium?
carbon monoxide;cobalt;3-cyclopenta-2,4-dien-1-ylpropyl(diphenyl)phosphanium has a molecular weight of 379.31 g/mol, XLogP of 4.16, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for carbon monoxide;cobalt;3-cyclopenta-2,4-dien-1-ylpropyl(diphenyl)phosphanium is sourced from PubChem (CID 11987204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).