About 1-cyclopenta-2,4-dien-1-ylpiperidine
1-cyclopenta-2,4-dien-1-ylpiperidine (PubChem CID 11987214) has the molecular formula C10H15N
and a molecular weight of 149.24 g/mol. Its IUPAC name is 1-cyclopenta-2,4-dien-1-ylpiperidine.
Molecular Properties
| Compound Name | 1-cyclopenta-2,4-dien-1-ylpiperidine |
| PubChem CID | 11987214 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | 1-cyclopenta-2,4-dien-1-ylpiperidine |
| SMILES | C1=CC(N2CCCCC2)C=C1 |
| InChI | InChI=1S/C10H15N/c1-4-8-11(9-5-1)10-6-2-3-7-10/h2-3,6-7,10H,1,4-5,8-9H2 |
| InChIKey | IAMZIMUNIOSGKB-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-cyclopenta-2,4-dien-1-ylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopenta-2,4-dien-1-ylpiperidine?
The IUPAC name of 1-cyclopenta-2,4-dien-1-ylpiperidine (CID 11987214) is 1-cyclopenta-2,4-dien-1-ylpiperidine.
What is the SMILES notation for 1-cyclopenta-2,4-dien-1-ylpiperidine?
The canonical SMILES for 1-cyclopenta-2,4-dien-1-ylpiperidine is C1=CC(N2CCCCC2)C=C1.
What is the InChIKey of 1-cyclopenta-2,4-dien-1-ylpiperidine?
The InChIKey is IAMZIMUNIOSGKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N/c1-4-8-11(9-5-1)10-6-2-3-7-10/h2-3,6-7,10H,1,4-5,8-9H2.
What are the key properties of 1-cyclopenta-2,4-dien-1-ylpiperidine?
1-cyclopenta-2,4-dien-1-ylpiperidine has a molecular weight of 149.24 g/mol, XLogP of 1.97, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopenta-2,4-dien-1-ylpiperidine is sourced from PubChem (CID 11987214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).