C19H30Cl2N4O2 — CID 119872711
(2R)-N-[2-(4-benzylpiperazin-1-yl)-2-oxoethyl]piperidine-2-carboxamide;dihydrochloride (PubChem CID 119872711) has the molecular formula C19H30Cl2N4O2 and a molecular weight of 417.38 g/mol. Its IUPAC name is (2R)-N-[2-(4-benzylpiperazin-1-yl)-2-oxoethyl]piperidine-2-carboxamide;dihydrochloride.
| Compound Name | (2R)-N-[2-(4-benzylpiperazin-1-yl)-2-oxoethyl]piperidine-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119872711 |
| Molecular Formula | C19H30Cl2N4O2 |
| Molecular Weight | 417.38 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | (2R)-N-[2-(4-benzylpiperazin-1-yl)-2-oxoethyl]piperidine-2-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(NCC(=O)N1CCN(Cc2ccccc2)CC1)[C@H]1CCCCN1 |
| InChI | InChI=1S/C19H28N4O2.2ClH/c24-18(14-21-19(25)17-8-4-5-9-20-17)23-12-10-22(11-13-23)15-16-6-2-1-3-7-16;;/h1-3,6-7,17,20H,4-5,8-15H2,(H,21,25);2*1H/t17-;;/m1../s1 |
| InChIKey | BJRRTIYZUNMAGP-ZEECNFPPSA-N |
| XLogP | 1.43 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.38 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |