C13H20Cl2N4O2 — CID 119873236
N-[3-oxo-3-(pyridin-3-ylamino)propyl]pyrrolidine-2-carboxamide;dihydrochloride (PubChem CID 119873236) has the molecular formula C13H20Cl2N4O2 and a molecular weight of 335.24 g/mol. Its IUPAC name is N-[3-oxo-3-(pyridin-3-ylamino)propyl]pyrrolidine-2-carboxamide;dihydrochloride.
| Compound Name | N-[3-oxo-3-(pyridin-3-ylamino)propyl]pyrrolidine-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119873236 |
| Molecular Formula | C13H20Cl2N4O2 |
| Molecular Weight | 335.24 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | N-[3-oxo-3-(pyridin-3-ylamino)propyl]pyrrolidine-2-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(CCNC(=O)C1CCCN1)Nc1cccnc1 |
| InChI | InChI=1S/C13H18N4O2.2ClH/c18-12(17-10-3-1-6-14-9-10)5-8-16-13(19)11-4-2-7-15-11;;/h1,3,6,9,11,15H,2,4-5,7-8H2,(H,16,19)(H,17,18);2*1H |
| InChIKey | MDAAPHFSAFMQKE-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.24 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |