C18H24Cl2N4O2 — CID 119873300
2-(4-aminophenyl)-N-[2-[methyl(2-pyridin-2-ylethyl)amino]-2-oxoethyl]acetamide;dihydrochloride (PubChem CID 119873300) has the molecular formula C18H24Cl2N4O2 and a molecular weight of 399.32 g/mol. Its IUPAC name is 2-(4-aminophenyl)-N-[2-[methyl(2-pyridin-2-ylethyl)amino]-2-oxoethyl]acetamide;dihydrochloride.
| Compound Name | 2-(4-aminophenyl)-N-[2-[methyl(2-pyridin-2-ylethyl)amino]-2-oxoethyl]acetamide;dihydrochloride |
|---|---|
| PubChem CID | 119873300 |
| Molecular Formula | C18H24Cl2N4O2 |
| Molecular Weight | 399.32 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 2-(4-aminophenyl)-N-[2-[methyl(2-pyridin-2-ylethyl)amino]-2-oxoethyl]acetamide;dihydrochloride |
| SMILES | CN(CCc1ccccn1)C(=O)CNC(=O)Cc1ccc(N)cc1.Cl.Cl |
| InChI | InChI=1S/C18H22N4O2.2ClH/c1-22(11-9-16-4-2-3-10-20-16)18(24)13-21-17(23)12-14-5-7-15(19)8-6-14;;/h2-8,10H,9,11-13,19H2,1H3,(H,21,23);2*1H |
| InChIKey | OSPKBYFKSLVDMH-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.32 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|