C24H49FeP2+6 — CID 11987336
2-di(propan-2-yl)phosphaniumylethyl-di(propan-2-yl)phosphanium;iron(5+);1,2,3,4,5-pentamethylcyclopenta-1,3-diene (PubChem CID 11987336) has the molecular formula C24H49FeP2+6 and a molecular weight of 455.45 g/mol. Its IUPAC name is 2-di(propan-2-yl)phosphaniumylethyl-di(propan-2-yl)phosphanium;iron(5+);1,2,3,4,5-pentamethylcyclopenta-1,3-diene.
| Compound Name | 2-di(propan-2-yl)phosphaniumylethyl-di(propan-2-yl)phosphanium;iron(5+);1,2,3,4,5-pentamethylcyclopenta-1,3-diene |
|---|---|
| PubChem CID | 11987336 |
| Molecular Formula | C24H49FeP2+6 |
| Molecular Weight | 455.45 g/mol |
| Exact Mass | 455.26 |
| IUPAC Name | 2-di(propan-2-yl)phosphaniumylethyl-di(propan-2-yl)phosphanium;iron(5+);1,2,3,4,5-pentamethylcyclopenta-1,3-diene |
| SMILES | CC(C)[PH+](CC[PH+](C(C)C)C(C)C)C(C)C.Cc1c(C)c(C)[c-](C)c1C.[Fe+5] |
| InChI | InChI=1S/C14H32P2.C10H15.Fe/c1-11(2)15(12(3)4)9-10-16(13(5)6)14(7)8;1-6-7(2)9(4)10(5)8(6)3;/h11-14H,9-10H2,1-8H3;1-5H3;/q;-1;+5/p+2 |
| InChIKey | AAYHCLCVQGIFHJ-UHFFFAOYSA-P |
| XLogP | 7.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.45 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|