C12H8F4O — CID 11987389
1-cyclopenta-2,4-dien-1-yl-2,3,4,5-tetrafluoro-6-methoxybenzene (PubChem CID 11987389) has the molecular formula C12H8F4O and a molecular weight of 244.19 g/mol. Its IUPAC name is 1-cyclopenta-2,4-dien-1-yl-2,3,4,5-tetrafluoro-6-methoxybenzene.
| Compound Name | 1-cyclopenta-2,4-dien-1-yl-2,3,4,5-tetrafluoro-6-methoxybenzene |
|---|---|
| PubChem CID | 11987389 |
| Molecular Formula | C12H8F4O |
| Molecular Weight | 244.19 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | 1-cyclopenta-2,4-dien-1-yl-2,3,4,5-tetrafluoro-6-methoxybenzene |
| SMILES | COc1c(F)c(F)c(F)c(F)c1C1C=CC=C1 |
| InChI | InChI=1S/C12H8F4O/c1-17-12-7(6-4-2-3-5-6)8(13)9(14)10(15)11(12)16/h2-6H,1H3 |
| InChIKey | BNDMENFQMSGDHC-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.19 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|