C12H27Cl2N3O2 — CID 119874866
3-amino-N-[[1-(2-methoxyethyl)pyrrolidin-2-yl]methyl]butanamide;dihydrochloride (PubChem CID 119874866) has the molecular formula C12H27Cl2N3O2 and a molecular weight of 316.27 g/mol. Its IUPAC name is 3-amino-N-[[1-(2-methoxyethyl)pyrrolidin-2-yl]methyl]butanamide;dihydrochloride.
| Compound Name | 3-amino-N-[[1-(2-methoxyethyl)pyrrolidin-2-yl]methyl]butanamide;dihydrochloride |
|---|---|
| PubChem CID | 119874866 |
| Molecular Formula | C12H27Cl2N3O2 |
| Molecular Weight | 316.27 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 3-amino-N-[[1-(2-methoxyethyl)pyrrolidin-2-yl]methyl]butanamide;dihydrochloride |
| SMILES | COCCN1CCCC1CNC(=O)CC(C)N.Cl.Cl |
| InChI | InChI=1S/C12H25N3O2.2ClH/c1-10(13)8-12(16)14-9-11-4-3-5-15(11)6-7-17-2;;/h10-11H,3-9,13H2,1-2H3,(H,14,16);2*1H |
| InChIKey | BVCKBUCBSXDEIV-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.27 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |