C15H21BrN4O2 — CID 119875009
1-amino-N-[2-[(5-bromo-2-pyridinyl)amino]-2-oxoethyl]-N-methylcyclohexane-1-carboxamide (PubChem CID 119875009) has the molecular formula C15H21BrN4O2 and a molecular weight of 369.26 g/mol. Its IUPAC name is 1-amino-N-[2-[(5-bromo-2-pyridinyl)amino]-2-oxoethyl]-N-methylcyclohexane-1-carboxamide.
| Compound Name | 1-amino-N-[2-[(5-bromo-2-pyridinyl)amino]-2-oxoethyl]-N-methylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 119875009 |
| Molecular Formula | C15H21BrN4O2 |
| Molecular Weight | 369.26 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | 1-amino-N-[2-[(5-bromo-2-pyridinyl)amino]-2-oxoethyl]-N-methylcyclohexane-1-carboxamide |
| SMILES | CN(CC(=O)Nc1ccc(Br)cn1)C(=O)C1(N)CCCCC1 |
| InChI | InChI=1S/C15H21BrN4O2/c1-20(14(22)15(17)7-3-2-4-8-15)10-13(21)19-12-6-5-11(16)9-18-12/h5-6,9H,2-4,7-8,10,17H2,1H3,(H,18,19,21) |
| InChIKey | HZQBVTSPVYIMOP-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.26 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |