C16H28N4O2 — CID 119876001
1-[4-(3-aminocyclopentanecarbonyl)piperazin-1-yl]-2-pyrrolidin-1-ylethanone (PubChem CID 119876001) has the molecular formula C16H28N4O2 and a molecular weight of 308.43 g/mol. Its IUPAC name is 1-[4-(3-aminocyclopentanecarbonyl)piperazin-1-yl]-2-pyrrolidin-1-ylethanone.
| Compound Name | 1-[4-(3-aminocyclopentanecarbonyl)piperazin-1-yl]-2-pyrrolidin-1-ylethanone |
|---|---|
| PubChem CID | 119876001 |
| Molecular Formula | C16H28N4O2 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.22 |
| IUPAC Name | 1-[4-(3-aminocyclopentanecarbonyl)piperazin-1-yl]-2-pyrrolidin-1-ylethanone |
| SMILES | NC1CCC(C(=O)N2CCN(C(=O)CN3CCCC3)CC2)C1 |
| InChI | InChI=1S/C16H28N4O2/c17-14-4-3-13(11-14)16(22)20-9-7-19(8-10-20)15(21)12-18-5-1-2-6-18/h13-14H,1-12,17H2 |
| InChIKey | FDOTVPKYEROBQT-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 69.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |