About 4-decylpyrrolidine-2,3,5-trione
4-decylpyrrolidine-2,3,5-trione (PubChem CID 11987631) has the molecular formula C14H23NO3
and a molecular weight of 253.34 g/mol. Its IUPAC name is 4-decylpyrrolidine-2,3,5-trione.
Molecular Properties
| Compound Name | 4-decylpyrrolidine-2,3,5-trione |
| PubChem CID | 11987631 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | 4-decylpyrrolidine-2,3,5-trione |
| SMILES | CCCCCCCCCCC1C(=O)NC(=O)C1=O |
| InChI | InChI=1S/C14H23NO3/c1-2-3-4-5-6-7-8-9-10-11-12(16)14(18)15-13(11)17/h11H,2-10H2,1H3,(H,15,17,18) |
| InChIKey | UDFGVXIMOMXNIC-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 4-decylpyrrolidine-2,3,5-trione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-decylpyrrolidine-2,3,5-trione?
The IUPAC name of 4-decylpyrrolidine-2,3,5-trione (CID 11987631) is 4-decylpyrrolidine-2,3,5-trione.
What is the SMILES notation for 4-decylpyrrolidine-2,3,5-trione?
The canonical SMILES for 4-decylpyrrolidine-2,3,5-trione is CCCCCCCCCCC1C(=O)NC(=O)C1=O.
What is the InChIKey of 4-decylpyrrolidine-2,3,5-trione?
The InChIKey is UDFGVXIMOMXNIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23NO3/c1-2-3-4-5-6-7-8-9-10-11-12(16)14(18)15-13(11)17/h11H,2-10H2,1H3,(H,15,17,18).
What are the key properties of 4-decylpyrrolidine-2,3,5-trione?
4-decylpyrrolidine-2,3,5-trione has a molecular weight of 253.34 g/mol, XLogP of 2.36, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-decylpyrrolidine-2,3,5-trione is sourced from PubChem (CID 11987631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).