C17H32N4O2 — CID 119876677
2-[4-(4-aminobutanoyl)piperazin-1-yl]-N-(4-methylcyclohexyl)acetamide (PubChem CID 119876677) has the molecular formula C17H32N4O2 and a molecular weight of 324.47 g/mol. Its IUPAC name is 2-[4-(4-aminobutanoyl)piperazin-1-yl]-N-(4-methylcyclohexyl)acetamide.
| Compound Name | 2-[4-(4-aminobutanoyl)piperazin-1-yl]-N-(4-methylcyclohexyl)acetamide |
|---|---|
| PubChem CID | 119876677 |
| Molecular Formula | C17H32N4O2 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.25 |
| IUPAC Name | 2-[4-(4-aminobutanoyl)piperazin-1-yl]-N-(4-methylcyclohexyl)acetamide |
| SMILES | CC1CCC(NC(=O)CN2CCN(C(=O)CCCN)CC2)CC1 |
| InChI | InChI=1S/C17H32N4O2/c1-14-4-6-15(7-5-14)19-16(22)13-20-9-11-21(12-10-20)17(23)3-2-8-18/h14-15H,2-13,18H2,1H3,(H,19,22) |
| InChIKey | UGGYCXJRNFRRJI-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |