C17H34Cl2N4O2 — CID 119876812
2-[4-(3-aminobutanoyl)piperazin-1-yl]-N-(3-methylcyclohexyl)acetamide;dihydrochloride (PubChem CID 119876812) has the molecular formula C17H34Cl2N4O2 and a molecular weight of 397.39 g/mol. Its IUPAC name is 2-[4-(3-aminobutanoyl)piperazin-1-yl]-N-(3-methylcyclohexyl)acetamide;dihydrochloride.
| Compound Name | 2-[4-(3-aminobutanoyl)piperazin-1-yl]-N-(3-methylcyclohexyl)acetamide;dihydrochloride |
|---|---|
| PubChem CID | 119876812 |
| Molecular Formula | C17H34Cl2N4O2 |
| Molecular Weight | 397.39 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | 2-[4-(3-aminobutanoyl)piperazin-1-yl]-N-(3-methylcyclohexyl)acetamide;dihydrochloride |
| SMILES | CC(N)CC(=O)N1CCN(CC(=O)NC2CCCC(C)C2)CC1.Cl.Cl |
| InChI | InChI=1S/C17H32N4O2.2ClH/c1-13-4-3-5-15(10-13)19-16(22)12-20-6-8-21(9-7-20)17(23)11-14(2)18;;/h13-15H,3-12,18H2,1-2H3,(H,19,22);2*1H |
| InChIKey | NIZPOCJXXXECSH-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.39 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |