About 2-amino-2-methyl-1-(1-methyl-3,5-dihydro-2H-1,4-benzodiazepin-4-yl)propan-1-one;dihydrochloride
2-amino-2-methyl-1-(1-methyl-3,5-dihydro-2H-1,4-benzodiazepin-4-yl)propan-1-one;dihydrochloride (PubChem CID 119876914) has the molecular formula C14H23Cl2N3O
and a molecular weight of 320.26 g/mol. Its IUPAC name is 2-amino-2-methyl-1-(1-methyl-3,5-dihydro-2H-1,4-benzodiazepin-4-yl)propan-1-one;dihydrochloride.
Molecular Properties
| Compound Name | 2-amino-2-methyl-1-(1-methyl-3,5-dihydro-2H-1,4-benzodiazepin-4-yl)propan-1-one;dihydrochloride |
| PubChem CID | 119876914 |
| Molecular Formula | C14H23Cl2N3O |
| Molecular Weight | 320.26 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 2-amino-2-methyl-1-(1-methyl-3,5-dihydro-2H-1,4-benzodiazepin-4-yl)propan-1-one;dihydrochloride |
| SMILES | CN1CCN(C(=O)C(C)(C)N)Cc2ccccc21.Cl.Cl |
| InChI | InChI=1S/C14H21N3O.2ClH/c1-14(2,15)13(18)17-9-8-16(3)12-7-5-4-6-11(12)10-17;;/h4-7H,8-10,15H2,1-3H3;2*1H |
| InChIKey | YNTFZVXTHACLEJ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.26 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-amino-2-methyl-1-(1-methyl-3,5-dihydro-2H-1,4-benzodiazepin-4-yl)propan-1-one;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-2-methyl-1-(1-methyl-3,5-dihydro-2H-1,4-benzodiazepin-4-yl)propan-1-one;dihydrochloride?
The IUPAC name of 2-amino-2-methyl-1-(1-methyl-3,5-dihydro-2H-1,4-benzodiazepin-4-yl)propan-1-one;dihydrochloride (CID 119876914) is 2-amino-2-methyl-1-(1-methyl-3,5-dihydro-2H-1,4-benzodiazepin-4-yl)propan-1-one;dihydrochloride.
What is the SMILES notation for 2-amino-2-methyl-1-(1-methyl-3,5-dihydro-2H-1,4-benzodiazepin-4-yl)propan-1-one;dihydrochloride?
The canonical SMILES for 2-amino-2-methyl-1-(1-methyl-3,5-dihydro-2H-1,4-benzodiazepin-4-yl)propan-1-one;dihydrochloride is CN1CCN(C(=O)C(C)(C)N)Cc2ccccc21.Cl.Cl.
What is the InChIKey of 2-amino-2-methyl-1-(1-methyl-3,5-dihydro-2H-1,4-benzodiazepin-4-yl)propan-1-one;dihydrochloride?
The InChIKey is YNTFZVXTHACLEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N3O.2ClH/c1-14(2,15)13(18)17-9-8-16(3)12-7-5-4-6-11(12)10-17;;/h4-7H,8-10,15H2,1-3H3;2*1H.
What are the key properties of 2-amino-2-methyl-1-(1-methyl-3,5-dihydro-2H-1,4-benzodiazepin-4-yl)propan-1-one;dihydrochloride?
2-amino-2-methyl-1-(1-methyl-3,5-dihydro-2H-1,4-benzodiazepin-4-yl)propan-1-one;dihydrochloride has a molecular weight of 320.26 g/mol, XLogP of 2.05, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-methyl-1-(1-methyl-3,5-dihydro-2H-1,4-benzodiazepin-4-yl)propan-1-one;dihydrochloride is sourced from PubChem (CID 119876914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).