C14H24N6O2 — CID 119877317
3-amino-N-[1-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]pyrazol-4-yl]butanamide (PubChem CID 119877317) has the molecular formula C14H24N6O2 and a molecular weight of 308.39 g/mol. Its IUPAC name is 3-amino-N-[1-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]pyrazol-4-yl]butanamide.
| Compound Name | 3-amino-N-[1-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]pyrazol-4-yl]butanamide |
|---|---|
| PubChem CID | 119877317 |
| Molecular Formula | C14H24N6O2 |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | 3-amino-N-[1-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]pyrazol-4-yl]butanamide |
| SMILES | CC(N)CC(=O)Nc1cnn(CC(=O)N2CCN(C)CC2)c1 |
| InChI | InChI=1S/C14H24N6O2/c1-11(15)7-13(21)17-12-8-16-20(9-12)10-14(22)19-5-3-18(2)4-6-19/h8-9,11H,3-7,10,15H2,1-2H3,(H,17,21) |
| InChIKey | KSLRXGHETDEASX-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 96.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |