C27H42O2 — CID 11987741
(1S,3Z)-3-[2-[(1R,3aS,7aR)-1-[(2R)-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-1,2,3,3a-tetrahydroinden-4-yl]ethylidene]-4-methylidenecyclohexan-1-ol (PubChem CID 11987741) has the molecular formula C27H42O2 and a molecular weight of 398.63 g/mol. Its IUPAC name is (1S,3Z)-3-[2-[(1R,3aS,7aR)-1-[(2R)-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-1,2,3,3a-tetrahydroinden-4-yl]ethylidene]-4-methylidenecyclohexan-1-ol.
| Compound Name | (1S,3Z)-3-[2-[(1R,3aS,7aR)-1-[(2R)-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-1,2,3,3a-tetrahydroinden-4-yl]ethylidene]-4-methylidenecyclohexan-1-ol |
|---|---|
| PubChem CID | 11987741 |
| Molecular Formula | C27H42O2 |
| Molecular Weight | 398.63 g/mol |
| Exact Mass | 398.32 |
| IUPAC Name | (1S,3Z)-3-[2-[(1R,3aS,7aR)-1-[(2R)-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-1,2,3,3a-tetrahydroinden-4-yl]ethylidene]-4-methylidenecyclohexan-1-ol |
| SMILES | C=C1CC[C@H](O)C/C1=C/CC1=CC=C[C@]2(C)[C@@H]([C@H](C)CCCC(C)(C)O)CC[C@@H]12 |
| InChI | InChI=1S/C27H42O2/c1-19-10-13-23(28)18-22(19)12-11-21-9-7-17-27(5)24(14-15-25(21)27)20(2)8-6-16-26(3,4)29/h7,9,12,17,20,23-25,28-29H,1,6,8,10-11,13-16,18H2,2-5H3/b22-12-/t20-,23+,24-,25+,27-/m1/s1 |
| InChIKey | IJNMTULJNDYRJB-PIFVAFGQSA-N |
| XLogP | 6.51 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.63 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |