C6H8O6 — CID 11987831
(2R,5R)-2-hydroxy-2,5-bis(hydroxymethyl)oxolane-3,4-dione (PubChem CID 11987831) has the molecular formula C6H8O6 and a molecular weight of 176.12 g/mol. Its IUPAC name is (2R,5R)-2-hydroxy-2,5-bis(hydroxymethyl)oxolane-3,4-dione.
| Compound Name | (2R,5R)-2-hydroxy-2,5-bis(hydroxymethyl)oxolane-3,4-dione |
|---|---|
| PubChem CID | 11987831 |
| Molecular Formula | C6H8O6 |
| Molecular Weight | 176.12 g/mol |
| Exact Mass | 176.03 |
| IUPAC Name | (2R,5R)-2-hydroxy-2,5-bis(hydroxymethyl)oxolane-3,4-dione |
| SMILES | O=C1C(=O)[C@@](O)(CO)O[C@@H]1CO |
| InChI | InChI=1S/C6H8O6/c7-1-3-4(9)5(10)6(11,2-8)12-3/h3,7-8,11H,1-2H2/t3-,6-/m1/s1 |
| InChIKey | YMORQEOGXUAETC-AWFVSMACSA-N |
| XLogP | -2.80 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.12 |
| LogP ≤ 5 | -2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|