C5H11NO4 — CID 11987837
(1R,2R,3S,4S)-5-aminocyclopentane-1,2,3,4-tetrol (PubChem CID 11987837) has the molecular formula C5H11NO4 and a molecular weight of 149.15 g/mol. Its IUPAC name is (1R,2R,3S,4S)-5-aminocyclopentane-1,2,3,4-tetrol.
| Compound Name | (1R,2R,3S,4S)-5-aminocyclopentane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 11987837 |
| Molecular Formula | C5H11NO4 |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.07 |
| IUPAC Name | (1R,2R,3S,4S)-5-aminocyclopentane-1,2,3,4-tetrol |
| SMILES | NC1[C@@H](O)[C@@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C5H11NO4/c6-1-2(7)4(9)5(10)3(1)8/h1-5,7-10H,6H2/t1?,2-,3+,4-,5+ |
| InChIKey | LZCRRHQKPAEPKL-ASQQECOQSA-N |
| XLogP | -3.23 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.15 |
| LogP ≤ 5 | -3.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |