C12H17NO4 — CID 11987838
(1S,2S,3R,4R)-5-(benzylamino)cyclopentane-1,2,3,4-tetrol (PubChem CID 11987838) has the molecular formula C12H17NO4 and a molecular weight of 239.27 g/mol. Its IUPAC name is (1S,2S,3R,4R)-5-(benzylamino)cyclopentane-1,2,3,4-tetrol.
| Compound Name | (1S,2S,3R,4R)-5-(benzylamino)cyclopentane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 11987838 |
| Molecular Formula | C12H17NO4 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | (1S,2S,3R,4R)-5-(benzylamino)cyclopentane-1,2,3,4-tetrol |
| SMILES | O[C@@H]1[C@H](O)[C@H](O)C(NCc2ccccc2)[C@@H]1O |
| InChI | InChI=1S/C12H17NO4/c14-9-8(10(15)12(17)11(9)16)13-6-7-4-2-1-3-5-7/h1-5,8-17H,6H2/t8?,9-,10+,11-,12+ |
| InChIKey | AQARFUBRAYWQBH-CQGIUEJESA-N |
| XLogP | -1.40 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |