C21H35Cl2N3O2 — CID 119878401
N-[4-(1-morpholin-4-ylethyl)phenyl]-3-piperidin-3-ylbutanamide;dihydrochloride (PubChem CID 119878401) has the molecular formula C21H35Cl2N3O2 and a molecular weight of 432.44 g/mol. Its IUPAC name is N-[4-(1-morpholin-4-ylethyl)phenyl]-3-piperidin-3-ylbutanamide;dihydrochloride.
| Compound Name | N-[4-(1-morpholin-4-ylethyl)phenyl]-3-piperidin-3-ylbutanamide;dihydrochloride |
|---|---|
| PubChem CID | 119878401 |
| Molecular Formula | C21H35Cl2N3O2 |
| Molecular Weight | 432.44 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | N-[4-(1-morpholin-4-ylethyl)phenyl]-3-piperidin-3-ylbutanamide;dihydrochloride |
| SMILES | CC(CC(=O)Nc1ccc(C(C)N2CCOCC2)cc1)C1CCCNC1.Cl.Cl |
| InChI | InChI=1S/C21H33N3O2.2ClH/c1-16(19-4-3-9-22-15-19)14-21(25)23-20-7-5-18(6-8-20)17(2)24-10-12-26-13-11-24;;/h5-8,16-17,19,22H,3-4,9-15H2,1-2H3,(H,23,25);2*1H |
| InChIKey | GKGAVMFBDGQPTC-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.44 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |