C14H27Cl2N3O2 — CID 119881544
3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl-(4-methoxypiperidin-4-yl)methanone;dihydrochloride (PubChem CID 119881544) has the molecular formula C14H27Cl2N3O2 and a molecular weight of 340.30 g/mol. Its IUPAC name is 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl-(4-methoxypiperidin-4-yl)methanone;dihydrochloride.
| Compound Name | 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl-(4-methoxypiperidin-4-yl)methanone;dihydrochloride |
|---|---|
| PubChem CID | 119881544 |
| Molecular Formula | C14H27Cl2N3O2 |
| Molecular Weight | 340.30 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl-(4-methoxypiperidin-4-yl)methanone;dihydrochloride |
| SMILES | COC1(C(=O)N2CCN3CCCC3C2)CCNCC1.Cl.Cl |
| InChI | InChI=1S/C14H25N3O2.2ClH/c1-19-14(4-6-15-7-5-14)13(18)17-10-9-16-8-2-3-12(16)11-17;;/h12,15H,2-11H2,1H3;2*1H |
| InChIKey | MJYCKBGFDILJDR-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.30 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |