C17H25Cl2N5O2 — CID 119882434
2-(4-aminophenyl)-1-[4-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]piperazin-1-yl]ethanone;dihydrochloride (PubChem CID 119882434) has the molecular formula C17H25Cl2N5O2 and a molecular weight of 402.33 g/mol. Its IUPAC name is 2-(4-aminophenyl)-1-[4-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]piperazin-1-yl]ethanone;dihydrochloride.
| Compound Name | 2-(4-aminophenyl)-1-[4-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]piperazin-1-yl]ethanone;dihydrochloride |
|---|---|
| PubChem CID | 119882434 |
| Molecular Formula | C17H25Cl2N5O2 |
| Molecular Weight | 402.33 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 2-(4-aminophenyl)-1-[4-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]piperazin-1-yl]ethanone;dihydrochloride |
| SMILES | CCc1nc(CN2CCN(C(=O)Cc3ccc(N)cc3)CC2)no1.Cl.Cl |
| InChI | InChI=1S/C17H23N5O2.2ClH/c1-2-16-19-15(20-24-16)12-21-7-9-22(10-8-21)17(23)11-13-3-5-14(18)6-4-13;;/h3-6H,2,7-12,18H2,1H3;2*1H |
| InChIKey | DKDUQIMSDOIQIT-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.33 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|