C17H24ClN3O — CID 119882542
1-amino-N-[1-(2-chlorophenyl)piperidin-3-yl]cyclopentane-1-carboxamide (PubChem CID 119882542) has the molecular formula C17H24ClN3O and a molecular weight of 321.85 g/mol. Its IUPAC name is 1-amino-N-[1-(2-chlorophenyl)piperidin-3-yl]cyclopentane-1-carboxamide.
| Compound Name | 1-amino-N-[1-(2-chlorophenyl)piperidin-3-yl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 119882542 |
| Molecular Formula | C17H24ClN3O |
| Molecular Weight | 321.85 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 1-amino-N-[1-(2-chlorophenyl)piperidin-3-yl]cyclopentane-1-carboxamide |
| SMILES | NC1(C(=O)NC2CCCN(c3ccccc3Cl)C2)CCCC1 |
| InChI | InChI=1S/C17H24ClN3O/c18-14-7-1-2-8-15(14)21-11-5-6-13(12-21)20-16(22)17(19)9-3-4-10-17/h1-2,7-8,13H,3-6,9-12,19H2,(H,20,22) |
| InChIKey | SKUHKACEOCFSKE-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.85 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |