C17H19F2N5O3 — CID 11988305
(5R)-3-[3,5-difluoro-4-(1,4-oxazepan-4-yl)phenyl]-5-(triazol-1-ylmethyl)-1,3-oxazolidin-2-one (PubChem CID 11988305) has the molecular formula C17H19F2N5O3 and a molecular weight of 379.37 g/mol. Its IUPAC name is (5R)-3-[3,5-difluoro-4-(1,4-oxazepan-4-yl)phenyl]-5-(triazol-1-ylmethyl)-1,3-oxazolidin-2-one.
| Compound Name | (5R)-3-[3,5-difluoro-4-(1,4-oxazepan-4-yl)phenyl]-5-(triazol-1-ylmethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11988305 |
| Molecular Formula | C17H19F2N5O3 |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | (5R)-3-[3,5-difluoro-4-(1,4-oxazepan-4-yl)phenyl]-5-(triazol-1-ylmethyl)-1,3-oxazolidin-2-one |
| SMILES | O=C1O[C@@H](Cn2ccnn2)CN1c1cc(F)c(N2CCCOCC2)c(F)c1 |
| InChI | InChI=1S/C17H19F2N5O3/c18-14-8-12(9-15(19)16(14)22-3-1-6-26-7-5-22)24-11-13(27-17(24)25)10-23-4-2-20-21-23/h2,4,8-9,13H,1,3,5-7,10-11H2/t13-/m0/s1 |
| InChIKey | UGKSXRUMBIXEMR-ZDUSSCGKSA-N |
| XLogP | 1.81 |
| TPSA | 72.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|