C29H28F7NO3 — CID 11988306
3-[(3aS,4R,5S,7aS)-5-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-4-(4-fluorophenyl)-1-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]cyclopent-2-en-1-one (PubChem CID 11988306) has the molecular formula C29H28F7NO3 and a molecular weight of 571.53 g/mol. Its IUPAC name is 3-[(3aS,4R,5S,7aS)-5-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-4-(4-fluorophenyl)-1-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]cyclopent-2-en-1-one.
| Compound Name | 3-[(3aS,4R,5S,7aS)-5-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-4-(4-fluorophenyl)-1-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 11988306 |
| Molecular Formula | C29H28F7NO3 |
| Molecular Weight | 571.53 g/mol |
| Exact Mass | 571.20 |
| IUPAC Name | 3-[(3aS,4R,5S,7aS)-5-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-4-(4-fluorophenyl)-1-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]cyclopent-2-en-1-one |
| SMILES | C[C@@H](O[C@H]1CC[C@@H]2C(O)N(C3=CC(=O)CC3)C[C@H]2[C@@H]1c1ccc(F)cc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C29H28F7NO3/c1-15(17-10-18(28(31,32)33)12-19(11-17)29(34,35)36)40-25-9-8-23-24(26(25)16-2-4-20(30)5-3-16)14-37(27(23)39)21-6-7-22(38)13-21/h2-5,10-13,15,23-27,39H,6-9,14H2,1H3/t15-,23+,24-,25+,26+,27?/m1/s1 |
| InChIKey | CDOVVCFDJIIOHB-GYNIFAGMSA-N |
| XLogP | 7.00 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.53 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |