About 5-methoxy-2-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]aniline
5-methoxy-2-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]aniline (PubChem CID 11988330) has the molecular formula C18H21NO4
and a molecular weight of 315.37 g/mol. Its IUPAC name is 5-methoxy-2-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]aniline.
Molecular Properties
| Compound Name | 5-methoxy-2-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]aniline |
| PubChem CID | 11988330 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 5-methoxy-2-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]aniline |
| SMILES | COc1ccc(/C=C\c2cc(OC)c(OC)c(OC)c2)c(N)c1 |
| InChI | InChI=1S/C18H21NO4/c1-20-14-8-7-13(15(19)11-14)6-5-12-9-16(21-2)18(23-4)17(10-12)22-3/h5-11H,19H2,1-4H3/b6-5- |
| InChIKey | XMMNPPLYAJJFPL-WAYWQWQTSA-N |
| XLogP | 3.47 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 5-methoxy-2-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-2-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]aniline?
The IUPAC name of 5-methoxy-2-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]aniline (CID 11988330) is 5-methoxy-2-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]aniline.
What is the SMILES notation for 5-methoxy-2-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]aniline?
The canonical SMILES for 5-methoxy-2-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]aniline is COc1ccc(/C=C\c2cc(OC)c(OC)c(OC)c2)c(N)c1.
What is the InChIKey of 5-methoxy-2-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]aniline?
The InChIKey is XMMNPPLYAJJFPL-WAYWQWQTSA-N. The full InChI is InChI=1S/C18H21NO4/c1-20-14-8-7-13(15(19)11-14)6-5-12-9-16(21-2)18(23-4)17(10-12)22-3/h5-11H,19H2,1-4H3/b6-5-.
What are the key properties of 5-methoxy-2-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]aniline?
5-methoxy-2-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]aniline has a molecular weight of 315.37 g/mol, XLogP of 3.47, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-2-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]aniline is sourced from PubChem (CID 11988330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).