C19H27N5O — CID 119883320
7-amino-N-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)phenyl]heptanamide (PubChem CID 119883320) has the molecular formula C19H27N5O and a molecular weight of 341.46 g/mol. Its IUPAC name is 7-amino-N-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)phenyl]heptanamide.
| Compound Name | 7-amino-N-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)phenyl]heptanamide |
|---|---|
| PubChem CID | 119883320 |
| Molecular Formula | C19H27N5O |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.22 |
| IUPAC Name | 7-amino-N-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)phenyl]heptanamide |
| SMILES | NCCCCCCC(=O)Nc1ccc(-c2nnc3n2CCCC3)cc1 |
| InChI | InChI=1S/C19H27N5O/c20-13-5-2-1-3-8-18(25)21-16-11-9-15(10-12-16)19-23-22-17-7-4-6-14-24(17)19/h9-12H,1-8,13-14,20H2,(H,21,25) |
| InChIKey | LJCHAPZDCMUUSA-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|