C14H29NO3 — CID 11988371
(2R,3S,4S,5R)-2-nonylpiperidine-3,4,5-triol (PubChem CID 11988371) has the molecular formula C14H29NO3 and a molecular weight of 259.39 g/mol. Its IUPAC name is (2R,3S,4S,5R)-2-nonylpiperidine-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R)-2-nonylpiperidine-3,4,5-triol |
|---|---|
| PubChem CID | 11988371 |
| Molecular Formula | C14H29NO3 |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.21 |
| IUPAC Name | (2R,3S,4S,5R)-2-nonylpiperidine-3,4,5-triol |
| SMILES | CCCCCCCCC[C@H]1NC[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C14H29NO3/c1-2-3-4-5-6-7-8-9-11-13(17)14(18)12(16)10-15-11/h11-18H,2-10H2,1H3/t11-,12-,13+,14+/m1/s1 |
| InChIKey | WVYPOMDXOXCTJU-MQYQWHSLSA-N |
| XLogP | 1.18 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|