C17H13F3N2O4 — CID 11988398
2-methoxy-N-[4-(2,2,2-trifluoroethoxy)-1,2-benzoxazol-3-yl]benzamide (PubChem CID 11988398) has the molecular formula C17H13F3N2O4 and a molecular weight of 366.30 g/mol. Its IUPAC name is 2-methoxy-N-[4-(2,2,2-trifluoroethoxy)-1,2-benzoxazol-3-yl]benzamide.
| Compound Name | 2-methoxy-N-[4-(2,2,2-trifluoroethoxy)-1,2-benzoxazol-3-yl]benzamide |
|---|---|
| PubChem CID | 11988398 |
| Molecular Formula | C17H13F3N2O4 |
| Molecular Weight | 366.30 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | 2-methoxy-N-[4-(2,2,2-trifluoroethoxy)-1,2-benzoxazol-3-yl]benzamide |
| SMILES | COc1ccccc1C(=O)Nc1noc2cccc(OCC(F)(F)F)c12 |
| InChI | InChI=1S/C17H13F3N2O4/c1-24-11-6-3-2-5-10(11)16(23)21-15-14-12(25-9-17(18,19)20)7-4-8-13(14)26-22-15/h2-8H,9H2,1H3,(H,21,22,23) |
| InChIKey | GWNYLYKPLJRWEU-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.30 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |