C20H19F3N2O3 — CID 11988399
4-tert-butyl-N-[4-(2,2,2-trifluoroethoxy)-1,2-benzoxazol-3-yl]benzamide (PubChem CID 11988399) has the molecular formula C20H19F3N2O3 and a molecular weight of 392.38 g/mol. Its IUPAC name is 4-tert-butyl-N-[4-(2,2,2-trifluoroethoxy)-1,2-benzoxazol-3-yl]benzamide.
| Compound Name | 4-tert-butyl-N-[4-(2,2,2-trifluoroethoxy)-1,2-benzoxazol-3-yl]benzamide |
|---|---|
| PubChem CID | 11988399 |
| Molecular Formula | C20H19F3N2O3 |
| Molecular Weight | 392.38 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | 4-tert-butyl-N-[4-(2,2,2-trifluoroethoxy)-1,2-benzoxazol-3-yl]benzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)Nc2noc3cccc(OCC(F)(F)F)c23)cc1 |
| InChI | InChI=1S/C20H19F3N2O3/c1-19(2,3)13-9-7-12(8-10-13)18(26)24-17-16-14(27-11-20(21,22)23)5-4-6-15(16)28-25-17/h4-10H,11H2,1-3H3,(H,24,25,26) |
| InChIKey | FTVUKKOLLTXDRN-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.38 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |