C16H10ClF3N2O3 — CID 11988400
3-chloro-N-[4-(2,2,2-trifluoroethoxy)-1,2-benzoxazol-3-yl]benzamide (PubChem CID 11988400) has the molecular formula C16H10ClF3N2O3 and a molecular weight of 370.71 g/mol. Its IUPAC name is 3-chloro-N-[4-(2,2,2-trifluoroethoxy)-1,2-benzoxazol-3-yl]benzamide.
| Compound Name | 3-chloro-N-[4-(2,2,2-trifluoroethoxy)-1,2-benzoxazol-3-yl]benzamide |
|---|---|
| PubChem CID | 11988400 |
| Molecular Formula | C16H10ClF3N2O3 |
| Molecular Weight | 370.71 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | 3-chloro-N-[4-(2,2,2-trifluoroethoxy)-1,2-benzoxazol-3-yl]benzamide |
| SMILES | O=C(Nc1noc2cccc(OCC(F)(F)F)c12)c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H10ClF3N2O3/c17-10-4-1-3-9(7-10)15(23)21-14-13-11(24-8-16(18,19)20)5-2-6-12(13)25-22-14/h1-7H,8H2,(H,21,22,23) |
| InChIKey | HZNNPGBPZRSEFP-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.71 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |