About N-(4-methoxy-1,2-benzoxazol-3-yl)-3,5-bis(trifluoromethyl)benzamide
N-(4-methoxy-1,2-benzoxazol-3-yl)-3,5-bis(trifluoromethyl)benzamide (PubChem CID 11988404) has the molecular formula C17H10F6N2O3
and a molecular weight of 404.27 g/mol. Its IUPAC name is N-(4-methoxy-1,2-benzoxazol-3-yl)-3,5-bis(trifluoromethyl)benzamide.
Molecular Properties
| Compound Name | N-(4-methoxy-1,2-benzoxazol-3-yl)-3,5-bis(trifluoromethyl)benzamide |
| PubChem CID | 11988404 |
| Molecular Formula | C17H10F6N2O3 |
| Molecular Weight | 404.27 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | N-(4-methoxy-1,2-benzoxazol-3-yl)-3,5-bis(trifluoromethyl)benzamide |
| SMILES | COc1cccc2onc(NC(=O)c3cc(C(F)(F)F)cc(C(F)(F)F)c3)c12 |
| InChI | InChI=1S/C17H10F6N2O3/c1-27-11-3-2-4-12-13(11)14(25-28-12)24-15(26)8-5-9(16(18,19)20)7-10(6-8)17(21,22)23/h2-7H,1H3,(H,24,25,26) |
| InChIKey | MATXZYLZYYWXLV-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 404.27 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(4-methoxy-1,2-benzoxazol-3-yl)-3,5-bis(trifluoromethyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-methoxy-1,2-benzoxazol-3-yl)-3,5-bis(trifluoromethyl)benzamide?
The IUPAC name of N-(4-methoxy-1,2-benzoxazol-3-yl)-3,5-bis(trifluoromethyl)benzamide (CID 11988404) is N-(4-methoxy-1,2-benzoxazol-3-yl)-3,5-bis(trifluoromethyl)benzamide.
What is the SMILES notation for N-(4-methoxy-1,2-benzoxazol-3-yl)-3,5-bis(trifluoromethyl)benzamide?
The canonical SMILES for N-(4-methoxy-1,2-benzoxazol-3-yl)-3,5-bis(trifluoromethyl)benzamide is COc1cccc2onc(NC(=O)c3cc(C(F)(F)F)cc(C(F)(F)F)c3)c12.
What is the InChIKey of N-(4-methoxy-1,2-benzoxazol-3-yl)-3,5-bis(trifluoromethyl)benzamide?
The InChIKey is MATXZYLZYYWXLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10F6N2O3/c1-27-11-3-2-4-12-13(11)14(25-28-12)24-15(26)8-5-9(16(18,19)20)7-10(6-8)17(21,22)23/h2-7H,1H3,(H,24,25,26).
What are the key properties of N-(4-methoxy-1,2-benzoxazol-3-yl)-3,5-bis(trifluoromethyl)benzamide?
N-(4-methoxy-1,2-benzoxazol-3-yl)-3,5-bis(trifluoromethyl)benzamide has a molecular weight of 404.27 g/mol, XLogP of 5.13, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-methoxy-1,2-benzoxazol-3-yl)-3,5-bis(trifluoromethyl)benzamide is sourced from PubChem (CID 11988404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).