About N-[[1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]piperidin-4-yl]methyl]-4-(methylamino)butanamide
N-[[1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]piperidin-4-yl]methyl]-4-(methylamino)butanamide (PubChem CID 119884290) has the molecular formula C17H30N4O2
and a molecular weight of 322.45 g/mol. Its IUPAC name is N-[[1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]piperidin-4-yl]methyl]-4-(methylamino)butanamide.
Molecular Properties
| Compound Name | N-[[1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]piperidin-4-yl]methyl]-4-(methylamino)butanamide |
| PubChem CID | 119884290 |
| Molecular Formula | C17H30N4O2 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.24 |
| IUPAC Name | N-[[1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]piperidin-4-yl]methyl]-4-(methylamino)butanamide |
| SMILES | CNCCCC(=O)NCC1CCN(Cc2nc(C)c(C)o2)CC1 |
| InChI | InChI=1S/C17H30N4O2/c1-13-14(2)23-17(20-13)12-21-9-6-15(7-10-21)11-19-16(22)5-4-8-18-3/h15,18H,4-12H2,1-3H3,(H,19,22) |
| InChIKey | IOQWMWPHLQFYAU-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 70.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[[1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]piperidin-4-yl]methyl]-4-(methylamino)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]piperidin-4-yl]methyl]-4-(methylamino)butanamide?
The IUPAC name of N-[[1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]piperidin-4-yl]methyl]-4-(methylamino)butanamide (CID 119884290) is N-[[1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]piperidin-4-yl]methyl]-4-(methylamino)butanamide.
What is the SMILES notation for N-[[1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]piperidin-4-yl]methyl]-4-(methylamino)butanamide?
The canonical SMILES for N-[[1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]piperidin-4-yl]methyl]-4-(methylamino)butanamide is CNCCCC(=O)NCC1CCN(Cc2nc(C)c(C)o2)CC1.
What is the InChIKey of N-[[1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]piperidin-4-yl]methyl]-4-(methylamino)butanamide?
The InChIKey is IOQWMWPHLQFYAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30N4O2/c1-13-14(2)23-17(20-13)12-21-9-6-15(7-10-21)11-19-16(22)5-4-8-18-3/h15,18H,4-12H2,1-3H3,(H,19,22).
What are the key properties of N-[[1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]piperidin-4-yl]methyl]-4-(methylamino)butanamide?
N-[[1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]piperidin-4-yl]methyl]-4-(methylamino)butanamide has a molecular weight of 322.45 g/mol, XLogP of 1.62, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]piperidin-4-yl]methyl]-4-(methylamino)butanamide is sourced from PubChem (CID 119884290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).