C13H19Cl2FN4O — CID 119885358
N-[(6-fluoro-1H-benzimidazol-2-yl)methyl]-4-(methylamino)butanamide;dihydrochloride (PubChem CID 119885358) has the molecular formula C13H19Cl2FN4O and a molecular weight of 337.23 g/mol. Its IUPAC name is N-[(6-fluoro-1H-benzimidazol-2-yl)methyl]-4-(methylamino)butanamide;dihydrochloride.
| Compound Name | N-[(6-fluoro-1H-benzimidazol-2-yl)methyl]-4-(methylamino)butanamide;dihydrochloride |
|---|---|
| PubChem CID | 119885358 |
| Molecular Formula | C13H19Cl2FN4O |
| Molecular Weight | 337.23 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | N-[(6-fluoro-1H-benzimidazol-2-yl)methyl]-4-(methylamino)butanamide;dihydrochloride |
| SMILES | CNCCCC(=O)NCc1nc2ccc(F)cc2[nH]1.Cl.Cl |
| InChI | InChI=1S/C13H17FN4O.2ClH/c1-15-6-2-3-13(19)16-8-12-17-10-5-4-9(14)7-11(10)18-12;;/h4-5,7,15H,2-3,6,8H2,1H3,(H,16,19)(H,17,18);2*1H |
| InChIKey | JSVRMDQEQAWUAJ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.23 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|