C23H37N3O — CID 119885767
2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[2-ethyl-2-(1-phenylethylamino)butyl]acetamide (PubChem CID 119885767) has the molecular formula C23H37N3O and a molecular weight of 371.57 g/mol. Its IUPAC name is 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[2-ethyl-2-(1-phenylethylamino)butyl]acetamide.
| Compound Name | 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[2-ethyl-2-(1-phenylethylamino)butyl]acetamide |
|---|---|
| PubChem CID | 119885767 |
| Molecular Formula | C23H37N3O |
| Molecular Weight | 371.57 g/mol |
| Exact Mass | 371.29 |
| IUPAC Name | 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[2-ethyl-2-(1-phenylethylamino)butyl]acetamide |
| SMILES | CCC(CC)(CNC(=O)CC1CC2CCC(C1)N2)NC(C)c1ccccc1 |
| InChI | InChI=1S/C23H37N3O/c1-4-23(5-2,26-17(3)19-9-7-6-8-10-19)16-24-22(27)15-18-13-20-11-12-21(14-18)25-20/h6-10,17-18,20-21,25-26H,4-5,11-16H2,1-3H3,(H,24,27) |
| InChIKey | VNLNWJQEWFZTOF-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.57 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |