C17H31Cl2N3O2 — CID 119885880
2-amino-N-[3-[3-(dimethylamino)propoxy]phenyl]-2-methylpentanamide;dihydrochloride (PubChem CID 119885880) has the molecular formula C17H31Cl2N3O2 and a molecular weight of 380.36 g/mol. Its IUPAC name is 2-amino-N-[3-[3-(dimethylamino)propoxy]phenyl]-2-methylpentanamide;dihydrochloride.
| Compound Name | 2-amino-N-[3-[3-(dimethylamino)propoxy]phenyl]-2-methylpentanamide;dihydrochloride |
|---|---|
| PubChem CID | 119885880 |
| Molecular Formula | C17H31Cl2N3O2 |
| Molecular Weight | 380.36 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 2-amino-N-[3-[3-(dimethylamino)propoxy]phenyl]-2-methylpentanamide;dihydrochloride |
| SMILES | CCCC(C)(N)C(=O)Nc1cccc(OCCCN(C)C)c1.Cl.Cl |
| InChI | InChI=1S/C17H29N3O2.2ClH/c1-5-10-17(2,18)16(21)19-14-8-6-9-15(13-14)22-12-7-11-20(3)4;;/h6,8-9,13H,5,7,10-12,18H2,1-4H3,(H,19,21);2*1H |
| InChIKey | HUHRUWICFWKJOC-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.36 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|