C51H81NO5Si2 — CID 11988600
[(3R,4S,5R,16S)-16-[tert-butyl(diphenyl)silyl]oxy-4-hydroxy-5-phenylmethoxy-2-(trimethylsilylmethyl)heptadec-1-en-3-yl] N,N-di(propan-2-yl)carbamate (PubChem CID 11988600) has the molecular formula C51H81NO5Si2 and a molecular weight of 844.38 g/mol. Its IUPAC name is [(3R,4S,5R,16S)-16-[tert-butyl(diphenyl)silyl]oxy-4-hydroxy-5-phenylmethoxy-2-(trimethylsilylmethyl)heptadec-1-en-3-yl] N,N-di(propan-2-yl)carbamate.
| Compound Name | [(3R,4S,5R,16S)-16-[tert-butyl(diphenyl)silyl]oxy-4-hydroxy-5-phenylmethoxy-2-(trimethylsilylmethyl)heptadec-1-en-3-yl] N,N-di(propan-2-yl)carbamate |
|---|---|
| PubChem CID | 11988600 |
| Molecular Formula | C51H81NO5Si2 |
| Molecular Weight | 844.38 g/mol |
| Exact Mass | 843.57 |
| IUPAC Name | [(3R,4S,5R,16S)-16-[tert-butyl(diphenyl)silyl]oxy-4-hydroxy-5-phenylmethoxy-2-(trimethylsilylmethyl)heptadec-1-en-3-yl] N,N-di(propan-2-yl)carbamate |
| SMILES | C=C(C[Si](C)(C)C)[C@@H](OC(=O)N(C(C)C)C(C)C)[C@@H](O)[C@@H](CCCCCCCCCC[C@H](C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OCc1ccccc1 |
| InChI | InChI=1S/C51H81NO5Si2/c1-40(2)52(41(3)4)50(54)56-49(42(5)39-58(10,11)12)48(53)47(55-38-44-31-23-19-24-32-44)37-29-18-16-14-13-15-17-22-30-43(6)57-59(51(7,8)9,45-33-25-20-26-34-45)46-35-27-21-28-36-46/h19-21,23-28,31-36,40-41,43,47-49,53H,5,13-18,22,29-30,37-39H2,1-4,6-12H3/t43-,47+,48-,49+/m0/s1 |
| InChIKey | AJCOAGZBQFHHFH-IPTRBDCPSA-N |
| XLogP | 12.32 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 844.38 |
| LogP ≤ 5 | 12.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|