C16H31N3O — CID 119887481
2-methyl-3-(methylamino)-1-[4-(4-methylcyclohexyl)piperazin-1-yl]propan-1-one (PubChem CID 119887481) has the molecular formula C16H31N3O and a molecular weight of 281.44 g/mol. Its IUPAC name is 2-methyl-3-(methylamino)-1-[4-(4-methylcyclohexyl)piperazin-1-yl]propan-1-one.
| Compound Name | 2-methyl-3-(methylamino)-1-[4-(4-methylcyclohexyl)piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 119887481 |
| Molecular Formula | C16H31N3O |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.25 |
| IUPAC Name | 2-methyl-3-(methylamino)-1-[4-(4-methylcyclohexyl)piperazin-1-yl]propan-1-one |
| SMILES | CNCC(C)C(=O)N1CCN(C2CCC(C)CC2)CC1 |
| InChI | InChI=1S/C16H31N3O/c1-13-4-6-15(7-5-13)18-8-10-19(11-9-18)16(20)14(2)12-17-3/h13-15,17H,4-12H2,1-3H3 |
| InChIKey | IGMMWMSONCSLFK-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |