C15H19F2N3O2 — CID 119887859
[4-(2,5-difluorophenyl)piperazin-1-yl]-morpholin-3-ylmethanone (PubChem CID 119887859) has the molecular formula C15H19F2N3O2 and a molecular weight of 311.33 g/mol. Its IUPAC name is [4-(2,5-difluorophenyl)piperazin-1-yl]-morpholin-3-ylmethanone.
| Compound Name | [4-(2,5-difluorophenyl)piperazin-1-yl]-morpholin-3-ylmethanone |
|---|---|
| PubChem CID | 119887859 |
| Molecular Formula | C15H19F2N3O2 |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | [4-(2,5-difluorophenyl)piperazin-1-yl]-morpholin-3-ylmethanone |
| SMILES | O=C(C1COCCN1)N1CCN(c2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C15H19F2N3O2/c16-11-1-2-12(17)14(9-11)19-4-6-20(7-5-19)15(21)13-10-22-8-3-18-13/h1-2,9,13,18H,3-8,10H2 |
| InChIKey | XQRFVIGMBSFKAR-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |