C16H8F6N2O3 — CID 11988794
2,3,4-trifluoro-N-[4-(2,2,2-trifluoroethoxy)-1,2-benzoxazol-3-yl]benzamide (PubChem CID 11988794) has the molecular formula C16H8F6N2O3 and a molecular weight of 390.24 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-[4-(2,2,2-trifluoroethoxy)-1,2-benzoxazol-3-yl]benzamide.
| Compound Name | 2,3,4-trifluoro-N-[4-(2,2,2-trifluoroethoxy)-1,2-benzoxazol-3-yl]benzamide |
|---|---|
| PubChem CID | 11988794 |
| Molecular Formula | C16H8F6N2O3 |
| Molecular Weight | 390.24 g/mol |
| Exact Mass | 390.04 |
| IUPAC Name | 2,3,4-trifluoro-N-[4-(2,2,2-trifluoroethoxy)-1,2-benzoxazol-3-yl]benzamide |
| SMILES | O=C(Nc1noc2cccc(OCC(F)(F)F)c12)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C16H8F6N2O3/c17-8-5-4-7(12(18)13(8)19)15(25)23-14-11-9(26-6-16(20,21)22)2-1-3-10(11)27-24-14/h1-5H,6H2,(H,23,24,25) |
| InChIKey | VFGVMVSOIIDLGM-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.24 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|