C36H26S2Si — CID 11988817
2-(2,3,4,5-tetraphenyl-1-thiophen-2-ylsilol-1-yl)thiophene (PubChem CID 11988817) has the molecular formula C36H26S2Si and a molecular weight of 550.82 g/mol. Its IUPAC name is 2-(2,3,4,5-tetraphenyl-1-thiophen-2-ylsilol-1-yl)thiophene.
| Compound Name | 2-(2,3,4,5-tetraphenyl-1-thiophen-2-ylsilol-1-yl)thiophene |
|---|---|
| PubChem CID | 11988817 |
| Molecular Formula | C36H26S2Si |
| Molecular Weight | 550.82 g/mol |
| Exact Mass | 550.12 |
| IUPAC Name | 2-(2,3,4,5-tetraphenyl-1-thiophen-2-ylsilol-1-yl)thiophene |
| SMILES | c1ccc(C2=C(c3ccccc3)[Si](c3cccs3)(c3cccs3)C(c3ccccc3)=C2c2ccccc2)cc1 |
| InChI | InChI=1S/C36H26S2Si/c1-5-15-27(16-6-1)33-34(28-17-7-2-8-18-28)36(30-21-11-4-12-22-30)39(31-23-13-25-37-31,32-24-14-26-38-32)35(33)29-19-9-3-10-20-29/h1-26H |
| InChIKey | QQTWVKARHXMTSU-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.82 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|